C7H6FIN2 — CID 129180671
4-fluoro-3-iodo-7-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 129180671) has the molecular formula C7H6FIN2 and a molecular weight of 264.04 g/mol. Its IUPAC name is 4-fluoro-3-iodo-7-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 4-fluoro-3-iodo-7-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 129180671 |
| Molecular Formula | C7H6FIN2 |
| Molecular Weight | 264.04 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 4-fluoro-3-iodo-7-methyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | Cn1[nH]c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C7H6FIN2/c1-11-7-2-4(8)5(9)3-6(7)10-11/h2-3,10H,1H3 |
| InChIKey | WKPFANVISDMCTQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.04 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|