About 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine
1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine (PubChem CID 129180685) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine.
Molecular Properties
| Compound Name | 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine |
| PubChem CID | 129180685 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine |
| SMILES | C=C/C(C)=C\C1CNN(C)C1C |
| InChI | InChI=1S/C10H18N2/c1-5-8(2)6-10-7-11-12(4)9(10)3/h5-6,9-11H,1,7H2,2-4H3/b8-6- |
| InChIKey | YHJPQKPOXCLPHN-VURMDHGXSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine?
The IUPAC name of 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine (CID 129180685) is 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine.
What is the SMILES notation for 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine?
The canonical SMILES for 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine is C=C/C(C)=C\C1CNN(C)C1C.
What is the InChIKey of 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine?
The InChIKey is YHJPQKPOXCLPHN-VURMDHGXSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-8(2)6-10-7-11-12(4)9(10)3/h5-6,9-11H,1,7H2,2-4H3/b8-6-.
What are the key properties of 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine?
1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine has a molecular weight of 166.27 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazolidine is sourced from PubChem (CID 129180685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).