About (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole
(7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole (PubChem CID 129180688) has the molecular formula C10H13FN2
and a molecular weight of 180.23 g/mol. Its IUPAC name is (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole.
Molecular Properties
| Compound Name | (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole |
| PubChem CID | 129180688 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole |
| SMILES | CC1=CC2C=NN(C)[C@]2(C)C=C1F |
| InChI | InChI=1S/C10H13FN2/c1-7-4-8-6-12-13(3)10(8,2)5-9(7)11/h4-6,8H,1-3H3/t8?,10-/m1/s1 |
| InChIKey | PMBNSOMORBNQJW-LHIURRSHSA-N |
| XLogP | 2.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole?
The IUPAC name of (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole (CID 129180688) is (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole.
What is the SMILES notation for (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole?
The canonical SMILES for (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole is CC1=CC2C=NN(C)[C@]2(C)C=C1F.
What is the InChIKey of (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole?
The InChIKey is PMBNSOMORBNQJW-LHIURRSHSA-N. The full InChI is InChI=1S/C10H13FN2/c1-7-4-8-6-12-13(3)10(8,2)5-9(7)11/h4-6,8H,1-3H3/t8?,10-/m1/s1.
What are the key properties of (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole?
(7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole has a molecular weight of 180.23 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7aS)-6-fluoro-1,5,7a-trimethyl-3aH-indazole is sourced from PubChem (CID 129180688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).