C8H14N2 — CID 129180692
N,N,5-trimethyl-2,3-dihydropyridin-2-amine (PubChem CID 129180692) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N,N,5-trimethyl-2,3-dihydropyridin-2-amine.
| Compound Name | N,N,5-trimethyl-2,3-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 129180692 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N,N,5-trimethyl-2,3-dihydropyridin-2-amine |
| SMILES | CC1=CCC(N(C)C)N=C1 |
| InChI | InChI=1S/C8H14N2/c1-7-4-5-8(9-6-7)10(2)3/h4,6,8H,5H2,1-3H3 |
| InChIKey | XQGYRZOFZRQKNS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |