C15H27N — CID 129180812
(5E,9E)-N-ethyl-5,9-dimethylundeca-5,9-dien-2-imine (PubChem CID 129180812) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (5E,9E)-N-ethyl-5,9-dimethylundeca-5,9-dien-2-imine.
| Compound Name | (5E,9E)-N-ethyl-5,9-dimethylundeca-5,9-dien-2-imine |
|---|---|
| PubChem CID | 129180812 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (5E,9E)-N-ethyl-5,9-dimethylundeca-5,9-dien-2-imine |
| SMILES | C/C=C(\C)CC/C=C(\C)CC/C(C)=N/CC |
| InChI | InChI=1S/C15H27N/c1-6-13(3)9-8-10-14(4)11-12-15(5)16-7-2/h6,10H,7-9,11-12H2,1-5H3/b13-6+,14-10+,16-15+ |
| InChIKey | GMEGVNJOXWLRDV-BTNOVYFSSA-N |
| XLogP | 4.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|