C30H45N5 — CID 129180958
N'-[2-[[(3E,5Z)-7-aminoocta-1,3,5-trien-3-yl]-[2-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]ethyl]amino]ethyl]-N-[(2Z,4Z,6E)-5-ethenylnona-2,4,6,8-tetraen-4-yl]methanimidamide (PubChem CID 129180958) has the molecular formula C30H45N5 and a molecular weight of 475.73 g/mol. Its IUPAC name is N'-[2-[[(3E,5Z)-7-aminoocta-1,3,5-trien-3-yl]-[2-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]ethyl]amino]ethyl]-N-[(2Z,4Z,6E)-5-ethenylnona-2,4,6,8-tetraen-4-yl]methanimidamide.
| Compound Name | N'-[2-[[(3E,5Z)-7-aminoocta-1,3,5-trien-3-yl]-[2-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]ethyl]amino]ethyl]-N-[(2Z,4Z,6E)-5-ethenylnona-2,4,6,8-tetraen-4-yl]methanimidamide |
|---|---|
| PubChem CID | 129180958 |
| Molecular Formula | C30H45N5 |
| Molecular Weight | 475.73 g/mol |
| Exact Mass | 475.37 |
| IUPAC Name | N'-[2-[[(3E,5Z)-7-aminoocta-1,3,5-trien-3-yl]-[2-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]ethyl]amino]ethyl]-N-[(2Z,4Z,6E)-5-ethenylnona-2,4,6,8-tetraen-4-yl]methanimidamide |
| SMILES | C=C/C=C/C(C=C)=C(/C=C\C)N/C=N/CCN(CCNC(/C=C\C)=C/C)/C(C=C)=C/C=C\C(C)N |
| InChI | InChI=1S/C30H45N5/c1-8-14-19-27(11-4)30(17-10-3)34-25-32-21-23-35(24-22-33-28(12-5)16-9-2)29(13-6)20-15-18-26(7)31/h8-20,25-26,33H,1,4,6,21-24,31H2,2-3,5,7H3,(H,32,34)/b16-9-,17-10-,18-15-,19-14+,28-12+,29-20+,30-27- |
| InChIKey | PIVXFJDRFPKFOV-CAGVKDHHSA-N |
| XLogP | 5.71 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.73 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|