C30H49NO2 — CID 129181069
3-[[3-[(6Z,9Z,12Z,15Z,18Z)-henicosa-6,9,12,15,18-pentaenyl]oxiran-2-yl]amino]-5-methylhexan-2-one (PubChem CID 129181069) has the molecular formula C30H49NO2 and a molecular weight of 455.73 g/mol. Its IUPAC name is 3-[[3-[(6Z,9Z,12Z,15Z,18Z)-henicosa-6,9,12,15,18-pentaenyl]oxiran-2-yl]amino]-5-methylhexan-2-one.
| Compound Name | 3-[[3-[(6Z,9Z,12Z,15Z,18Z)-henicosa-6,9,12,15,18-pentaenyl]oxiran-2-yl]amino]-5-methylhexan-2-one |
|---|---|
| PubChem CID | 129181069 |
| Molecular Formula | C30H49NO2 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.38 |
| IUPAC Name | 3-[[3-[(6Z,9Z,12Z,15Z,18Z)-henicosa-6,9,12,15,18-pentaenyl]oxiran-2-yl]amino]-5-methylhexan-2-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC1OC1NC(CC(C)C)C(C)=O |
| InChI | InChI=1S/C30H49NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29-30(33-29)31-28(27(4)32)25-26(2)3/h6-7,9-10,12-13,15-16,18-19,26,28-31H,5,8,11,14,17,20-25H2,1-4H3/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | YMYSRCGSGUCESF-WMPRHZDHSA-N |
| XLogP | 8.01 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|