About ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate
ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate (PubChem CID 12918126) has the molecular formula C6H9Cl3N2O2
and a molecular weight of 247.51 g/mol. Its IUPAC name is ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate |
| PubChem CID | 12918126 |
| Molecular Formula | C6H9Cl3N2O2 |
| Molecular Weight | 247.51 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate |
| SMILES | CCOC(=O)C/N=C(\N)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H9Cl3N2O2/c1-2-13-4(12)3-11-5(10)6(7,8)9/h2-3H2,1H3,(H2,10,11) |
| InChIKey | KZMYDLONICMCJP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate?
The IUPAC name of ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate (CID 12918126) is ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate.
What is the SMILES notation for ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate?
The canonical SMILES for ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate is CCOC(=O)C/N=C(\N)C(Cl)(Cl)Cl.
What is the InChIKey of ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate?
The InChIKey is KZMYDLONICMCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Cl3N2O2/c1-2-13-4(12)3-11-5(10)6(7,8)9/h2-3H2,1H3,(H2,10,11).
What are the key properties of ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate?
ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate has a molecular weight of 247.51 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1-amino-2,2,2-trichloroethylidene)amino]acetate is sourced from PubChem (CID 12918126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).