About (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone
(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone (PubChem CID 129181363) has the molecular formula C18H28FNO
and a molecular weight of 293.43 g/mol. Its IUPAC name is (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone.
Molecular Properties
| Compound Name | (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone |
| PubChem CID | 129181363 |
| Molecular Formula | C18H28FNO |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone |
| SMILES | CC1(C)CCN(C(C)(C)C)C=C1C(=O)C1=CCC(F)CC1 |
| InChI | InChI=1S/C18H28FNO/c1-17(2,3)20-11-10-18(4,5)15(12-20)16(21)13-6-8-14(19)9-7-13/h6,12,14H,7-11H2,1-5H3 |
| InChIKey | MYTLEBAEYRTVNO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone?
The IUPAC name of (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone (CID 129181363) is (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone.
What is the SMILES notation for (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone?
The canonical SMILES for (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone is CC1(C)CCN(C(C)(C)C)C=C1C(=O)C1=CCC(F)CC1.
What is the InChIKey of (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone?
The InChIKey is MYTLEBAEYRTVNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28FNO/c1-17(2,3)20-11-10-18(4,5)15(12-20)16(21)13-6-8-14(19)9-7-13/h6,12,14H,7-11H2,1-5H3.
What are the key properties of (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone?
(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone has a molecular weight of 293.43 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-(4-fluorocyclohexen-1-yl)methanone is sourced from PubChem (CID 129181363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).