C36H50N2O4 — CID 129181385
methyl 2,5-bis[(E)-3-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-oxoprop-1-enyl]benzoate (PubChem CID 129181385) has the molecular formula C36H50N2O4 and a molecular weight of 574.81 g/mol. Its IUPAC name is methyl 2,5-bis[(E)-3-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 2,5-bis[(E)-3-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 129181385 |
| Molecular Formula | C36H50N2O4 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.38 |
| IUPAC Name | methyl 2,5-bis[(E)-3-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1cc(/C=C/C(=O)C2=CN(C(C)(C)C)CCC2(C)C)ccc1/C=C/C(=O)C1=CN(C(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C36H50N2O4/c1-33(2,3)37-20-18-35(7,8)28(23-37)30(39)16-13-25-12-14-26(27(22-25)32(41)42-11)15-17-31(40)29-24-38(34(4,5)6)21-19-36(29,9)10/h12-17,22-24H,18-21H2,1-11H3/b16-13+,17-15+ |
| InChIKey | WURVUMAOQCADKD-NLEMEUKFSA-N |
| XLogP | 7.47 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|