About N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide
N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide (PubChem CID 129181456) has the molecular formula C13H20N6O
and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide.
Molecular Properties
| Compound Name | N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide |
| PubChem CID | 129181456 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide |
| SMILES | Cc1[nH]nc(NCCCc2[nH]nc(NC=O)c2C)c1C |
| InChI | InChI=1S/C13H20N6O/c1-8-10(3)16-18-12(8)14-6-4-5-11-9(2)13(15-7-20)19-17-11/h7H,4-6H2,1-3H3,(H2,14,16,18)(H2,15,17,19,20) |
| InChIKey | YWBVDKWWBSYHAW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide?
The IUPAC name of N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide (CID 129181456) is N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide.
What is the SMILES notation for N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide?
The canonical SMILES for N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide is Cc1[nH]nc(NCCCc2[nH]nc(NC=O)c2C)c1C.
What is the InChIKey of N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide?
The InChIKey is YWBVDKWWBSYHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O/c1-8-10(3)16-18-12(8)14-6-4-5-11-9(2)13(15-7-20)19-17-11/h7H,4-6H2,1-3H3,(H2,14,16,18)(H2,15,17,19,20).
What are the key properties of N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide?
N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide has a molecular weight of 276.34 g/mol, XLogP of 1.67, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[3-[(4,5-dimethyl-1H-pyrazol-3-yl)amino]propyl]-4-methyl-1H-pyrazol-3-yl]formamide is sourced from PubChem (CID 129181456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).