About 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one
7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one (PubChem CID 129181664) has the molecular formula C8H9IN2O2
and a molecular weight of 292.08 g/mol. Its IUPAC name is 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one |
| PubChem CID | 129181664 |
| Molecular Formula | C8H9IN2O2 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one |
| SMILES | O=c1cc2n(cc1O)CCN(I)C2 |
| InChI | InChI=1S/C8H9IN2O2/c9-11-2-1-10-5-8(13)7(12)3-6(10)4-11/h3,5,13H,1-2,4H2 |
| InChIKey | BGKHBMOTHURXJY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one?
The IUPAC name of 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one (CID 129181664) is 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one.
What is the SMILES notation for 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one?
The canonical SMILES for 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one is O=c1cc2n(cc1O)CCN(I)C2.
What is the InChIKey of 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one?
The InChIKey is BGKHBMOTHURXJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IN2O2/c9-11-2-1-10-5-8(13)7(12)3-6(10)4-11/h3,5,13H,1-2,4H2.
What are the key properties of 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one?
7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one has a molecular weight of 292.08 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2-iodo-3,4-dihydro-1H-pyrido[1,2-a]pyrazin-8-one is sourced from PubChem (CID 129181664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).