About (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine
(3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine (PubChem CID 129181692) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine |
| PubChem CID | 129181692 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine |
| SMILES | C=C/C=C(\CC)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C14H27N3/c1-4-7-14(5-2)15-8-6-9-17-12-10-16(3)11-13-17/h4,7,15H,1,5-6,8-13H2,2-3H3/b14-7+ |
| InChIKey | WWFFGBVJDRFGHF-VGOFMYFVSA-N |
| XLogP | 1.69 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine?
The IUPAC name of (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine (CID 129181692) is (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine.
What is the SMILES notation for (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine?
The canonical SMILES for (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine is C=C/C=C(\CC)NCCCN1CCN(C)CC1.
What is the InChIKey of (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine?
The InChIKey is WWFFGBVJDRFGHF-VGOFMYFVSA-N. The full InChI is InChI=1S/C14H27N3/c1-4-7-14(5-2)15-8-6-9-17-12-10-16(3)11-13-17/h4,7,15H,1,5-6,8-13H2,2-3H3/b14-7+.
What are the key properties of (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine?
(3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine has a molecular weight of 237.39 g/mol, XLogP of 1.69, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-[3-(4-methylpiperazin-1-yl)propyl]hexa-3,5-dien-3-amine is sourced from PubChem (CID 129181692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).