C11H7F2N5 — CID 129181901
3-(5,7-difluoro-1H-indol-3-yl)-1,2,4-triazin-5-amine (PubChem CID 129181901) has the molecular formula C11H7F2N5 and a molecular weight of 247.21 g/mol. Its IUPAC name is 3-(5,7-difluoro-1H-indol-3-yl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(5,7-difluoro-1H-indol-3-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 129181901 |
| Molecular Formula | C11H7F2N5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-(5,7-difluoro-1H-indol-3-yl)-1,2,4-triazin-5-amine |
| SMILES | Nc1cnnc(-c2c[nH]c3c(F)cc(F)cc23)n1 |
| InChI | InChI=1S/C11H7F2N5/c12-5-1-6-7(3-15-10(6)8(13)2-5)11-17-9(14)4-16-18-11/h1-4,15H,(H2,14,17,18) |
| InChIKey | BYVFVFMGNWQDLW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |