C16H30N2O2 — CID 129182033
2-[(1S,3R)-3-methylcyclohexyl]-3,4,6,7,8,10,11,11a-octahydro-1H-pyrazino[2,1-d][1,5]oxazocin-7-ol (PubChem CID 129182033) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[(1S,3R)-3-methylcyclohexyl]-3,4,6,7,8,10,11,11a-octahydro-1H-pyrazino[2,1-d][1,5]oxazocin-7-ol.
| Compound Name | 2-[(1S,3R)-3-methylcyclohexyl]-3,4,6,7,8,10,11,11a-octahydro-1H-pyrazino[2,1-d][1,5]oxazocin-7-ol |
|---|---|
| PubChem CID | 129182033 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-[(1S,3R)-3-methylcyclohexyl]-3,4,6,7,8,10,11,11a-octahydro-1H-pyrazino[2,1-d][1,5]oxazocin-7-ol |
| SMILES | C[C@@H]1CCC[C@H](N2CCN3CC(O)COCCC3C2)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-13-3-2-4-14(9-13)17-6-7-18-11-16(19)12-20-8-5-15(18)10-17/h13-16,19H,2-12H2,1H3/t13-,14+,15?,16?/m1/s1 |
| InChIKey | IROPFUVIOLNFKM-QVOMUQBLSA-N |
| XLogP | 1.33 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |