About 5-nitro-2,3-dihydro-1,3-thiazol-2-amine
5-nitro-2,3-dihydro-1,3-thiazol-2-amine (PubChem CID 129182230) has the molecular formula C3H5N3O2S
and a molecular weight of 147.16 g/mol. Its IUPAC name is 5-nitro-2,3-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-nitro-2,3-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 129182230 |
| Molecular Formula | C3H5N3O2S |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.01 |
| IUPAC Name | 5-nitro-2,3-dihydro-1,3-thiazol-2-amine |
| SMILES | NC1NC=C([N+](=O)[O-])S1 |
| InChI | InChI=1S/C3H5N3O2S/c4-3-5-1-2(9-3)6(7)8/h1,3,5H,4H2 |
| InChIKey | AADSVZMDZIAKOT-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2,3-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2,3-dihydro-1,3-thiazol-2-amine?
The IUPAC name of 5-nitro-2,3-dihydro-1,3-thiazol-2-amine (CID 129182230) is 5-nitro-2,3-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for 5-nitro-2,3-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for 5-nitro-2,3-dihydro-1,3-thiazol-2-amine is NC1NC=C([N+](=O)[O-])S1.
What is the InChIKey of 5-nitro-2,3-dihydro-1,3-thiazol-2-amine?
The InChIKey is AADSVZMDZIAKOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O2S/c4-3-5-1-2(9-3)6(7)8/h1,3,5H,4H2.
What are the key properties of 5-nitro-2,3-dihydro-1,3-thiazol-2-amine?
5-nitro-2,3-dihydro-1,3-thiazol-2-amine has a molecular weight of 147.16 g/mol, XLogP of -0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2,3-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 129182230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).