C16H21N3 — CID 129182277
(E)-2-methyl-3-(2,4,6,10-tetramethyl-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-dien-5-yl)prop-2-enenitrile (PubChem CID 129182277) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (E)-2-methyl-3-(2,4,6,10-tetramethyl-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-dien-5-yl)prop-2-enenitrile.
| Compound Name | (E)-2-methyl-3-(2,4,6,10-tetramethyl-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-dien-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 129182277 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (E)-2-methyl-3-(2,4,6,10-tetramethyl-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-dien-5-yl)prop-2-enenitrile |
| SMILES | CC1=C(/C=C(\C)C#N)C2(C)CC2(C)C2N(C)C=CN12 |
| InChI | InChI=1S/C16H21N3/c1-11(9-17)8-13-12(2)19-7-6-18(5)14(19)16(4)10-15(13,16)3/h6-8,14H,10H2,1-5H3/b11-8+ |
| InChIKey | IHVKAUYNGPBUFF-DHZHZOJOSA-N |
| XLogP | 3.20 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|