C11H13F2NO2 — CID 129182679
ethyl (2Z,5Z,7E)-2,7-difluoro-8-(methylideneamino)octa-2,5,7-trienoate (PubChem CID 129182679) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is ethyl (2Z,5Z,7E)-2,7-difluoro-8-(methylideneamino)octa-2,5,7-trienoate.
| Compound Name | ethyl (2Z,5Z,7E)-2,7-difluoro-8-(methylideneamino)octa-2,5,7-trienoate |
|---|---|
| PubChem CID | 129182679 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | ethyl (2Z,5Z,7E)-2,7-difluoro-8-(methylideneamino)octa-2,5,7-trienoate |
| SMILES | C=N/C=C(F)\C=C/C/C=C(\F)C(=O)OCC |
| InChI | InChI=1S/C11H13F2NO2/c1-3-16-11(15)10(13)7-5-4-6-9(12)8-14-2/h4,6-8H,2-3,5H2,1H3/b6-4-,9-8+,10-7- |
| InChIKey | AMQIATCQFJURQS-UBJJAYGUSA-N |
| XLogP | 2.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|