C13H26O3 — CID 129183104
(3R)-4-ethyl-3-(2-hydroxyethyl)-4,5-dimethylheptanoic acid (PubChem CID 129183104) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (3R)-4-ethyl-3-(2-hydroxyethyl)-4,5-dimethylheptanoic acid.
| Compound Name | (3R)-4-ethyl-3-(2-hydroxyethyl)-4,5-dimethylheptanoic acid |
|---|---|
| PubChem CID | 129183104 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (3R)-4-ethyl-3-(2-hydroxyethyl)-4,5-dimethylheptanoic acid |
| SMILES | CCC(C)C(C)(CC)[C@H](CCO)CC(=O)O |
| InChI | InChI=1S/C13H26O3/c1-5-10(3)13(4,6-2)11(7-8-14)9-12(15)16/h10-11,14H,5-9H2,1-4H3,(H,15,16)/t10?,11-,13?/m1/s1 |
| InChIKey | UKUGFIIACBAAFU-QWKFWESOSA-N |
| XLogP | 2.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |