C28H36N2O9 — CID 129184157
2-hydroxypropan-2-yl 4-[[3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobutanoate (PubChem CID 129184157) has the molecular formula C28H36N2O9 and a molecular weight of 544.60 g/mol. Its IUPAC name is 2-hydroxypropan-2-yl 4-[[3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobutanoate.
| Compound Name | 2-hydroxypropan-2-yl 4-[[3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 129184157 |
| Molecular Formula | C28H36N2O9 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-hydroxypropan-2-yl 4-[[3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobutanoate |
| SMILES | COc1ccc2c3c1O[C@@H]1C(OC(=O)CCNC(=O)CCC(=O)OC(C)(C)O)=CC[C@]4(O)[C@H](C2)N(C)CC[C@@]314 |
| InChI | InChI=1S/C28H36N2O9/c1-26(2,34)39-22(33)8-7-20(31)29-13-10-21(32)37-18-9-11-28(35)19-15-16-5-6-17(36-4)24-23(16)27(28,25(18)38-24)12-14-30(19)3/h5-6,9,19,25,34-35H,7-8,10-15H2,1-4H3,(H,29,31)/t19-,25+,27+,28-/m0/s1 |
| InChIKey | BCQMBAFNMUEUHH-PANKTVPPSA-N |
| XLogP | 1.07 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|