C19H25NO11 — CID 129184283
1-O-butyl 4-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetyl]oxybutanedioate (PubChem CID 129184283) has the molecular formula C19H25NO11 and a molecular weight of 443.41 g/mol. Its IUPAC name is 1-O-butyl 4-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetyl]oxybutanedioate.
| Compound Name | 1-O-butyl 4-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetyl]oxybutanedioate |
|---|---|
| PubChem CID | 129184283 |
| Molecular Formula | C19H25NO11 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-O-butyl 4-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetyl]oxybutanedioate |
| SMILES | CCCCOC(=O)[C@H](CC(=O)ON1C(=O)CCC1=O)OC(=O)C[C@@H]1OC(C)(C)OC1=O |
| InChI | InChI=1S/C19H25NO11/c1-4-5-8-27-17(25)11(9-16(24)31-20-13(21)6-7-14(20)22)28-15(23)10-12-18(26)30-19(2,3)29-12/h11-12H,4-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | HIAFXFLHEKWGMQ-RYUDHWBXSA-N |
| XLogP | 0.31 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|