C7F16NO3S+ — CID 129185039
1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,5,5,6,6-nonafluoromorpholin-4-ium-4-yl)propane-1-sulfonyl fluoride (PubChem CID 129185039) has the molecular formula C7F16NO3S+ and a molecular weight of 482.12 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,5,5,6,6-nonafluoromorpholin-4-ium-4-yl)propane-1-sulfonyl fluoride.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,5,5,6,6-nonafluoromorpholin-4-ium-4-yl)propane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 129185039 |
| Molecular Formula | C7F16NO3S+ |
| Molecular Weight | 482.12 g/mol |
| Exact Mass | 481.93 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,5,5,6,6-nonafluoromorpholin-4-ium-4-yl)propane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)[N+]1(F)C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C7F16NO3S/c8-1(9,7(20,21)28(23,25)26)2(10,11)24(22)3(12,13)5(16,17)27-6(18,19)4(24,14)15/q+1 |
| InChIKey | MSOBVIPFWBQROC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.12 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|