C12H17N3 — CID 129185211
2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)guanidine (PubChem CID 129185211) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)guanidine.
| Compound Name | 2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)guanidine |
|---|---|
| PubChem CID | 129185211 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)guanidine |
| SMILES | NC(N)=Nc1cccc2c1CCCCC2 |
| InChI | InChI=1S/C12H17N3/c13-12(14)15-11-8-4-6-9-5-2-1-3-7-10(9)11/h4,6,8H,1-3,5,7H2,(H4,13,14,15) |
| InChIKey | XKKLHPKBKKJFMP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|