About N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide
N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide (PubChem CID 129186478) has the molecular formula C14H21NO4S
and a molecular weight of 299.39 g/mol. Its IUPAC name is N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide |
| PubChem CID | 129186478 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide |
| SMILES | CCOC(CCCNC(=O)c1ccc(C=O)s1)OCC |
| InChI | InChI=1S/C14H21NO4S/c1-3-18-13(19-4-2)6-5-9-15-14(17)12-8-7-11(10-16)20-12/h7-8,10,13H,3-6,9H2,1-2H3,(H,15,17) |
| InChIKey | LXDVSDNTXZEHFK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide?
The IUPAC name of N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide (CID 129186478) is N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide.
What is the SMILES notation for N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide?
The canonical SMILES for N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide is CCOC(CCCNC(=O)c1ccc(C=O)s1)OCC.
What is the InChIKey of N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide?
The InChIKey is LXDVSDNTXZEHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4S/c1-3-18-13(19-4-2)6-5-9-15-14(17)12-8-7-11(10-16)20-12/h7-8,10,13H,3-6,9H2,1-2H3,(H,15,17).
What are the key properties of N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide?
N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide has a molecular weight of 299.39 g/mol, XLogP of 2.47, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-diethoxybutyl)-5-formylthiophene-2-carboxamide is sourced from PubChem (CID 129186478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).