About 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid
5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid (PubChem CID 129186816) has the molecular formula C19H13Br2N3O2
and a molecular weight of 475.14 g/mol. Its IUPAC name is 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid |
| PubChem CID | 129186816 |
| Molecular Formula | C19H13Br2N3O2 |
| Molecular Weight | 475.14 g/mol |
| Exact Mass | 472.94 |
| IUPAC Name | 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid |
| SMILES | Brc1cnc2[nH]c(-c3ccccc3)cc2c1.O=C(O)c1cccc(Br)n1 |
| InChI | InChI=1S/C13H9BrN2.C6H4BrNO2/c14-11-6-10-7-12(16-13(10)15-8-11)9-4-2-1-3-5-9;7-5-3-1-2-4(8-5)6(9)10/h1-8H,(H,15,16);1-3H,(H,9,10) |
| InChIKey | KFOWDIIEEZIBBC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.14 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid?
The IUPAC name of 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid (CID 129186816) is 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid.
What is the SMILES notation for 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid?
The canonical SMILES for 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid is Brc1cnc2[nH]c(-c3ccccc3)cc2c1.O=C(O)c1cccc(Br)n1.
What is the InChIKey of 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid?
The InChIKey is KFOWDIIEEZIBBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2.C6H4BrNO2/c14-11-6-10-7-12(16-13(10)15-8-11)9-4-2-1-3-5-9;7-5-3-1-2-4(8-5)6(9)10/h1-8H,(H,15,16);1-3H,(H,9,10).
What are the key properties of 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid?
5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid has a molecular weight of 475.14 g/mol, XLogP of 5.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine;6-bromopyridine-2-carboxylic acid is sourced from PubChem (CID 129186816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).