C27H33N3O3 — CID 129187131
1-N,3-N,3-N,2,4,6-hexakis(prop-2-enyl)benzene-1,3,5-tricarboxamide (PubChem CID 129187131) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-N,3-N,3-N,2,4,6-hexakis(prop-2-enyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,3-N,2,4,6-hexakis(prop-2-enyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 129187131 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-N,3-N,3-N,2,4,6-hexakis(prop-2-enyl)benzene-1,3,5-tricarboxamide |
| SMILES | C=CCNC(=O)c1c(CC=C)c(C(N)=O)c(CC=C)c(C(=O)N(CC=C)CC=C)c1CC=C |
| InChI | InChI=1S/C27H33N3O3/c1-7-13-19-22(25(28)31)20(14-8-2)24(27(33)30(17-11-5)18-12-6)21(15-9-3)23(19)26(32)29-16-10-4/h7-12H,1-6,13-18H2,(H2,28,31)(H,29,32) |
| InChIKey | ULLYBBMUYZYQEL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|