C23H17BrO4 — CID 129187230
2-bromo-1,7-dimethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 129187230) has the molecular formula C23H17BrO4 and a molecular weight of 437.29 g/mol. Its IUPAC name is 2-bromo-1,7-dimethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | 2-bromo-1,7-dimethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 129187230 |
| Molecular Formula | C23H17BrO4 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-bromo-1,7-dimethyl-8,9-diphenyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CC12C(=O)C(C)(C(c3ccccc3)=C1c1ccccc1)C1(Br)C(=O)OC(=O)C21 |
| InChI | InChI=1S/C23H17BrO4/c1-21-15(13-9-5-3-6-10-13)16(14-11-7-4-8-12-14)22(2,19(21)26)23(24)17(21)18(25)28-20(23)27/h3-12,17H,1-2H3 |
| InChIKey | WKMWWRDFZBBHKO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|