C34H41NO3 — CID 129187825
(2S)-2-[5,8-dimethyl-7-(4-methylphenyl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 129187825) has the molecular formula C34H41NO3 and a molecular weight of 511.71 g/mol. Its IUPAC name is (2S)-2-[5,8-dimethyl-7-(4-methylphenyl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | (2S)-2-[5,8-dimethyl-7-(4-methylphenyl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 129187825 |
| Molecular Formula | C34H41NO3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | (2S)-2-[5,8-dimethyl-7-(4-methylphenyl)-2-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-1H-isoquinolin-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1ccc(-c2c(C)c3c(c(C)c2[C@H](OC(C)(C)C)C(=O)O)CCN(C2CCc4ccccc4C2)C3)cc1 |
| InChI | InChI=1S/C34H41NO3/c1-21-11-13-25(14-12-21)30-23(3)29-20-35(27-16-15-24-9-7-8-10-26(24)19-27)18-17-28(29)22(2)31(30)32(33(36)37)38-34(4,5)6/h7-14,27,32H,15-20H2,1-6H3,(H,36,37)/t27?,32-/m0/s1 |
| InChIKey | XSFAXRWXLGLEEM-YCUNKVRLSA-N |
| XLogP | 7.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |