C18H22INO5 — CID 129187915
2-hydroxy-2-[7-iodo-5,8-dimethyl-2-(oxan-4-yl)-3-oxo-1,4-dihydroisoquinolin-6-yl]acetic acid (PubChem CID 129187915) has the molecular formula C18H22INO5 and a molecular weight of 459.28 g/mol. Its IUPAC name is 2-hydroxy-2-[7-iodo-5,8-dimethyl-2-(oxan-4-yl)-3-oxo-1,4-dihydroisoquinolin-6-yl]acetic acid.
| Compound Name | 2-hydroxy-2-[7-iodo-5,8-dimethyl-2-(oxan-4-yl)-3-oxo-1,4-dihydroisoquinolin-6-yl]acetic acid |
|---|---|
| PubChem CID | 129187915 |
| Molecular Formula | C18H22INO5 |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 2-hydroxy-2-[7-iodo-5,8-dimethyl-2-(oxan-4-yl)-3-oxo-1,4-dihydroisoquinolin-6-yl]acetic acid |
| SMILES | Cc1c(I)c(C(O)C(=O)O)c(C)c2c1CN(C1CCOCC1)C(=O)C2 |
| InChI | InChI=1S/C18H22INO5/c1-9-12-7-14(21)20(11-3-5-25-6-4-11)8-13(12)10(2)16(19)15(9)17(22)18(23)24/h11,17,22H,3-8H2,1-2H3,(H,23,24) |
| InChIKey | QPTBUDGJZFWQEV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|