About 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane
3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 129188334) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 129188334 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | O=[N+]([O-])CCC1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C10H17NO4/c12-11(13)7-4-9-8-14-10(15-9)5-2-1-3-6-10/h9H,1-8H2 |
| InChIKey | XCVSMLTZTCMDJR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane (CID 129188334) is 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane is O=[N+]([O-])CCC1COC2(CCCCC2)O1.
What is the InChIKey of 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is XCVSMLTZTCMDJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c12-11(13)7-4-9-8-14-10(15-9)5-2-1-3-6-10/h9H,1-8H2.
What are the key properties of 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane?
3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 215.25 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-nitroethyl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 129188334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).