About 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one
1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one (PubChem CID 12918841) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one |
| PubChem CID | 12918841 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one |
| SMILES | CN1C(=O)N(c2cc(C(C)(C)C)on2)C(O)C1O |
| InChI | InChI=1S/C11H17N3O4/c1-11(2,3)6-5-7(12-18-6)14-9(16)8(15)13(4)10(14)17/h5,8-9,15-16H,1-4H3 |
| InChIKey | XAEAEFQXDBCTPL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one?
The IUPAC name of 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one (CID 12918841) is 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one.
What is the SMILES notation for 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one?
The canonical SMILES for 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one is CN1C(=O)N(c2cc(C(C)(C)C)on2)C(O)C1O.
What is the InChIKey of 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one?
The InChIKey is XAEAEFQXDBCTPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-11(2,3)6-5-7(12-18-6)14-9(16)8(15)13(4)10(14)17/h5,8-9,15-16H,1-4H3.
What are the key properties of 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one?
1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one has a molecular weight of 255.27 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-tert-butyl-1,2-oxazol-3-yl)-4,5-dihydroxy-3-methylimidazolidin-2-one is sourced from PubChem (CID 12918841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).