C21H19F3N2O4S2 — CID 129188580
1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide (PubChem CID 129188580) has the molecular formula C21H19F3N2O4S2 and a molecular weight of 484.52 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 129188580 |
| Molecular Formula | C21H19F3N2O4S2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[(3S,4R)-4-hydroxy-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
| SMILES | Cc1cnc(C[C@H]2COc3cc(-c4ccccc4NS(=O)(=O)C(F)(F)F)ccc3[C@@H]2O)s1 |
| InChI | InChI=1S/C21H19F3N2O4S2/c1-12-10-25-19(31-12)9-14-11-30-18-8-13(6-7-16(18)20(14)27)15-4-2-3-5-17(15)26-32(28,29)21(22,23)24/h2-8,10,14,20,26-27H,9,11H2,1H3/t14-,20+/m0/s1 |
| InChIKey | XMKBRYVDGNDSKT-VBKZILBWSA-N |
| XLogP | 4.66 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |