C25H19F4N3O4S2 — CID 129188620
1,1,1-trifluoro-N-[4-fluoro-2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide (PubChem CID 129188620) has the molecular formula C25H19F4N3O4S2 and a molecular weight of 565.57 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[4-fluoro-2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[4-fluoro-2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 129188620 |
| Molecular Formula | C25H19F4N3O4S2 |
| Molecular Weight | 565.57 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 1,1,1-trifluoro-N-[4-fluoro-2-[(3S,4R)-4-hydroxy-3-[[5-(1,3-thiazol-5-yl)-2-pyridinyl]methyl]-3,4-dihydro-2H-chromen-7-yl]phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cc1-c1ccc2c(c1)OC[C@H](Cc1ccc(-c3cncs3)cn1)[C@H]2O)C(F)(F)F |
| InChI | InChI=1S/C25H19F4N3O4S2/c26-17-3-6-21(32-38(34,35)25(27,28)29)20(9-17)14-2-5-19-22(8-14)36-12-16(24(19)33)7-18-4-1-15(10-31-18)23-11-30-13-37-23/h1-6,8-11,13,16,24,32-33H,7,12H2/t16-,24+/m0/s1 |
| InChIKey | HAUJJCMYBHQMEA-UPCLLVRISA-N |
| XLogP | 5.56 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |