About (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine
(3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine (PubChem CID 129188710) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine |
| PubChem CID | 129188710 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine |
| SMILES | Cc1ncc([C@@H]2CCON2)cc1F |
| InChI | InChI=1S/C9H11FN2O/c1-6-8(10)4-7(5-11-6)9-2-3-13-12-9/h4-5,9,12H,2-3H2,1H3/t9-/m0/s1 |
| InChIKey | MRTRHRNGRSZLRB-VIFPVBQESA-N |
| XLogP | 1.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine?
The IUPAC name of (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine (CID 129188710) is (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine.
What is the SMILES notation for (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine?
The canonical SMILES for (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine is Cc1ncc([C@@H]2CCON2)cc1F.
What is the InChIKey of (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine?
The InChIKey is MRTRHRNGRSZLRB-VIFPVBQESA-N. The full InChI is InChI=1S/C9H11FN2O/c1-6-8(10)4-7(5-11-6)9-2-3-13-12-9/h4-5,9,12H,2-3H2,1H3/t9-/m0/s1.
What are the key properties of (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine?
(3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine has a molecular weight of 182.20 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(5-fluoro-6-methyl-3-pyridinyl)-1,2-oxazolidine is sourced from PubChem (CID 129188710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).