C13H13F3N2O2 — CID 129188731
(2,2-difluoro-1-methylcyclopropyl)-[(3S)-3-(6-fluoro-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone (PubChem CID 129188731) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is (2,2-difluoro-1-methylcyclopropyl)-[(3S)-3-(6-fluoro-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone.
| Compound Name | (2,2-difluoro-1-methylcyclopropyl)-[(3S)-3-(6-fluoro-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone |
|---|---|
| PubChem CID | 129188731 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (2,2-difluoro-1-methylcyclopropyl)-[(3S)-3-(6-fluoro-3-pyridinyl)-1,2-oxazolidin-2-yl]methanone |
| SMILES | CC1(C(=O)N2OCC[C@H]2c2ccc(F)nc2)CC1(F)F |
| InChI | InChI=1S/C13H13F3N2O2/c1-12(7-13(12,15)16)11(19)18-9(4-5-20-18)8-2-3-10(14)17-6-8/h2-3,6,9H,4-5,7H2,1H3/t9-,12?/m0/s1 |
| InChIKey | JIPOOOKBKYGBAO-QHGLUPRGSA-N |
| XLogP | 2.47 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|