About 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine
3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine (PubChem CID 129188732) has the molecular formula C8H9FN2O
and a molecular weight of 168.17 g/mol. Its IUPAC name is 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine |
| PubChem CID | 129188732 |
| Molecular Formula | C8H9FN2O |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine |
| SMILES | Fc1ccc(C2CCON2)cn1 |
| InChI | InChI=1S/C8H9FN2O/c9-8-2-1-6(5-10-8)7-3-4-12-11-7/h1-2,5,7,11H,3-4H2 |
| InChIKey | FBTYVMFFJWOWQY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine?
The IUPAC name of 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine (CID 129188732) is 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine.
What is the SMILES notation for 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine?
The canonical SMILES for 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine is Fc1ccc(C2CCON2)cn1.
What is the InChIKey of 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine?
The InChIKey is FBTYVMFFJWOWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O/c9-8-2-1-6(5-10-8)7-3-4-12-11-7/h1-2,5,7,11H,3-4H2.
What are the key properties of 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine?
3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine has a molecular weight of 168.17 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-fluoro-3-pyridinyl)-1,2-oxazolidine is sourced from PubChem (CID 129188732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).