About [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone
[(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone (PubChem CID 129188796) has the molecular formula C15H17F2NO3
and a molecular weight of 297.30 g/mol. Its IUPAC name is [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone.
Molecular Properties
| Compound Name | [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone |
| PubChem CID | 129188796 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone |
| SMILES | CC1(C(=O)N2OCC[C@H]2c2ccc(F)c(F)c2)CCOC1 |
| InChI | InChI=1S/C15H17F2NO3/c1-15(5-7-20-9-15)14(19)18-13(4-6-21-18)10-2-3-11(16)12(17)8-10/h2-3,8,13H,4-7,9H2,1H3/t13-,15?/m0/s1 |
| InChIKey | OHJHQSMQCFALHT-CFMCSPIPSA-N |
| XLogP | 2.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone?
The IUPAC name of [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone (CID 129188796) is [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone.
What is the SMILES notation for [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone?
The canonical SMILES for [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone is CC1(C(=O)N2OCC[C@H]2c2ccc(F)c(F)c2)CCOC1.
What is the InChIKey of [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone?
The InChIKey is OHJHQSMQCFALHT-CFMCSPIPSA-N. The full InChI is InChI=1S/C15H17F2NO3/c1-15(5-7-20-9-15)14(19)18-13(4-6-21-18)10-2-3-11(16)12(17)8-10/h2-3,8,13H,4-7,9H2,1H3/t13-,15?/m0/s1.
What are the key properties of [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone?
[(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone has a molecular weight of 297.30 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-(3,4-difluorophenyl)-1,2-oxazolidin-2-yl]-(3-methyloxolan-3-yl)methanone is sourced from PubChem (CID 129188796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).