C8H5F12NO2 — CID 129188949
3,3,3-trifluoro-2-[fluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]propan-1-ol (PubChem CID 129188949) has the molecular formula C8H5F12NO2 and a molecular weight of 375.11 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[fluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]propan-1-ol.
| Compound Name | 3,3,3-trifluoro-2-[fluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]propan-1-ol |
|---|---|
| PubChem CID | 129188949 |
| Molecular Formula | C8H5F12NO2 |
| Molecular Weight | 375.11 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 3,3,3-trifluoro-2-[fluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]propan-1-ol |
| SMILES | OCC(C(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H5F12NO2/c9-3(2(1-22)4(10,11)12)21-5(13,14)7(17,18)23-8(19,20)6(21,15)16/h2-3,22H,1H2 |
| InChIKey | HJFSZFLHZLZMIK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.11 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|