C8H8F9NO2 — CID 129188953
4-fluoro-4-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butan-1-ol (PubChem CID 129188953) has the molecular formula C8H8F9NO2 and a molecular weight of 321.14 g/mol. Its IUPAC name is 4-fluoro-4-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butan-1-ol.
| Compound Name | 4-fluoro-4-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 129188953 |
| Molecular Formula | C8H8F9NO2 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-fluoro-4-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butan-1-ol |
| SMILES | OCCCC(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H8F9NO2/c9-4(2-1-3-19)18-5(10,11)7(14,15)20-8(16,17)6(18,12)13/h4,19H,1-3H2 |
| InChIKey | WSNYRGRKGMVQBO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|