C10H4F18N2O — CID 129188958
2,3,3,3-tetrafluoro-2-[fluoro-[2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]methyl]propan-1-ol (PubChem CID 129188958) has the molecular formula C10H4F18N2O and a molecular weight of 510.12 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[fluoro-[2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]methyl]propan-1-ol.
| Compound Name | 2,3,3,3-tetrafluoro-2-[fluoro-[2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]methyl]propan-1-ol |
|---|---|
| PubChem CID | 129188958 |
| Molecular Formula | C10H4F18N2O |
| Molecular Weight | 510.12 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[fluoro-[2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]methyl]propan-1-ol |
| SMILES | OCC(F)(C(F)N1C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F18N2O/c11-2(3(12,1-31)4(13,14)15)29-7(21,22)9(25,26)30(6(19,20)5(16,17)18)10(27,28)8(29,23)24/h2,31H,1H2 |
| InChIKey | ZSGHWFUULVPJNF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.12 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|