C24H34O — CID 129189388
(Z)-8-[(1R,2S)-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]oct-6-en-2-one (PubChem CID 129189388) has the molecular formula C24H34O and a molecular weight of 338.53 g/mol. Its IUPAC name is (Z)-8-[(1R,2S)-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]oct-6-en-2-one.
| Compound Name | (Z)-8-[(1R,2S)-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]oct-6-en-2-one |
|---|---|
| PubChem CID | 129189388 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (Z)-8-[(1R,2S)-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]oct-6-en-2-one |
| SMILES | CC(=O)CCC/C=C\C[C@H]1CCC[C@@H]1/C=C/CCCc1ccccc1 |
| InChI | InChI=1S/C24H34O/c1-21(25)13-6-2-3-10-17-23-19-12-20-24(23)18-11-5-9-16-22-14-7-4-8-15-22/h3-4,7-8,10-11,14-15,18,23-24H,2,5-6,9,12-13,16-17,19-20H2,1H3/b10-3-,18-11+/t23-,24-/m0/s1 |
| InChIKey | MTTZLMWICOMPMQ-RHRSMMIQSA-N |
| XLogP | 6.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|