C31H28O12 — CID 129189469
[(3S,4R,6S)-6-[5,7-dihydroxy-2-(4-methylphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 129189469) has the molecular formula C31H28O12 and a molecular weight of 592.55 g/mol. Its IUPAC name is [(3S,4R,6S)-6-[5,7-dihydroxy-2-(4-methylphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(3S,4R,6S)-6-[5,7-dihydroxy-2-(4-methylphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 129189469 |
| Molecular Formula | C31H28O12 |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | [(3S,4R,6S)-6-[5,7-dihydroxy-2-(4-methylphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | Cc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)[C@@H](O)C2O)cc1 |
| InChI | InChI=1S/C31H28O12/c1-15-2-7-17(8-3-15)29-30(26(37)24-20(34)12-19(33)13-21(24)41-29)43-31-28(39)27(38)25(36)22(42-31)14-40-23(35)11-6-16-4-9-18(32)10-5-16/h2-13,22,25,27-28,31-34,36,38-39H,14H2,1H3/b11-6+/t22?,25-,27-,28?,31+/m1/s1 |
| InChIKey | CXRNQUSDYGZCNP-BTYQSLLZSA-N |
| XLogP | 2.33 |
| TPSA | 196.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|