C10H16F3NO2 — CID 129189896
(2S,3R)-2-(hydroxymethyl)-1-[(Z)-5,5,5-trifluoropent-3-enyl]pyrrolidin-3-ol (PubChem CID 129189896) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is (2S,3R)-2-(hydroxymethyl)-1-[(Z)-5,5,5-trifluoropent-3-enyl]pyrrolidin-3-ol.
| Compound Name | (2S,3R)-2-(hydroxymethyl)-1-[(Z)-5,5,5-trifluoropent-3-enyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129189896 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (2S,3R)-2-(hydroxymethyl)-1-[(Z)-5,5,5-trifluoropent-3-enyl]pyrrolidin-3-ol |
| SMILES | OC[C@H]1[C@H](O)CCN1CC/C=C\C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO2/c11-10(12,13)4-1-2-5-14-6-3-9(16)8(14)7-15/h1,4,8-9,15-16H,2-3,5-7H2/b4-1-/t8-,9+/m0/s1 |
| InChIKey | YLSKBJFJXWWYPC-MVHPKMBFSA-N |
| XLogP | 0.92 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|