C12H20O2 — CID 129189949
(3Z,5E)-5-methoxy-4-(2-methoxyethyl)-3-methylhepta-1,3,5-triene (PubChem CID 129189949) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3Z,5E)-5-methoxy-4-(2-methoxyethyl)-3-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-methoxy-4-(2-methoxyethyl)-3-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 129189949 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3Z,5E)-5-methoxy-4-(2-methoxyethyl)-3-methylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C(CCOC)\C(=C/C)OC |
| InChI | InChI=1S/C12H20O2/c1-6-10(3)11(8-9-13-4)12(7-2)14-5/h6-7H,1,8-9H2,2-5H3/b11-10-,12-7+ |
| InChIKey | LPUIDXHRSNXNJF-LVILPVEGSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|