C11H17NO2 — CID 129189991
N-[(3E,5E)-5-methoxy-4-(methoxymethyl)hepta-1,3,5-trien-3-yl]methanimine (PubChem CID 129189991) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(3E,5E)-5-methoxy-4-(methoxymethyl)hepta-1,3,5-trien-3-yl]methanimine.
| Compound Name | N-[(3E,5E)-5-methoxy-4-(methoxymethyl)hepta-1,3,5-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 129189991 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(3E,5E)-5-methoxy-4-(methoxymethyl)hepta-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C(N=C)=C(COC)\C(=C/C)OC |
| InChI | InChI=1S/C11H17NO2/c1-6-10(12-3)9(8-13-4)11(7-2)14-5/h6-7H,1,3,8H2,2,4-5H3/b10-9+,11-7+ |
| InChIKey | UGXPJSRVASDWJV-FVSXOECNSA-N |
| XLogP | 2.32 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|