C19H26F4O6 — CID 129190166
[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 129190166) has the molecular formula C19H26F4O6 and a molecular weight of 426.40 g/mol. Its IUPAC name is [3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 129190166 |
| Molecular Formula | C19H26F4O6 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C(F)(F)C(F)(F)OC(=O)C1CC2CCC1C2 |
| InChI | InChI=1S/C19H26F4O6/c1-4-17(2,3)15(25)27-7-8-28-16(26)18(20,21)19(22,23)29-14(24)13-10-11-5-6-12(13)9-11/h11-13H,4-10H2,1-3H3 |
| InChIKey | DZAJSUBCCJXIRY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|