About [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate
[2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 129190174) has the molecular formula C29H50O2
and a molecular weight of 430.72 g/mol. Its IUPAC name is [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| PubChem CID | 129190174 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC1CCCC(C2(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)C3CC4CC(C3)CC2C4)C1 |
| InChI | InChI=1S/C29H50O2/c1-19-10-9-11-22(12-19)29(23-14-20-13-21(16-23)17-24(29)15-20)31-25(30)28(8,27(5,6)7)18-26(2,3)4/h19-24H,9-18H2,1-8H3 |
| InChIKey | KBYRRDOWXFABDX-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate (CID 129190174) is [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate is CC1CCCC(C2(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)C3CC4CC(C3)CC2C4)C1.
What is the InChIKey of [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is KBYRRDOWXFABDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H50O2/c1-19-10-9-11-22(12-19)29(23-14-20-13-21(16-23)17-24(29)15-20)31-25(30)28(8,27(5,6)7)18-26(2,3)4/h19-24H,9-18H2,1-8H3.
What are the key properties of [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
[2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 430.72 g/mol, XLogP of 8.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-methylcyclohexyl)-2-adamantyl] 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 129190174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).