About 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene
6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene (PubChem CID 129190394) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene.
Analyze 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene?
The IUPAC name of 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene (CID 129190394) is 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene.
What is the SMILES notation for 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene?
The canonical SMILES for 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene is CC1=C=NC=NN=C1C.
What is the InChIKey of 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene?
The InChIKey is ZBMNTHCKUTXTFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-5-3-7-4-8-9-6(5)2/h4H,1-2H3.
What are the key properties of 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene?
6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene has a molecular weight of 121.14 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1,2,4-triazacyclohepta-2,4,5,7-tetraene is sourced from PubChem (CID 129190394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).