C46H75NO4 — CID 129190512
2-[2-[(9Z)-9-[(3E)-4,5-dipentylcyclooct-3-en-1-ylidene]nonoxy]-2-nonoxyethyl]isoindole-1,3-dione (PubChem CID 129190512) has the molecular formula C46H75NO4 and a molecular weight of 706.11 g/mol. Its IUPAC name is 2-[2-[(9Z)-9-[(3E)-4,5-dipentylcyclooct-3-en-1-ylidene]nonoxy]-2-nonoxyethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(9Z)-9-[(3E)-4,5-dipentylcyclooct-3-en-1-ylidene]nonoxy]-2-nonoxyethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129190512 |
| Molecular Formula | C46H75NO4 |
| Molecular Weight | 706.11 g/mol |
| Exact Mass | 705.57 |
| IUPAC Name | 2-[2-[(9Z)-9-[(3E)-4,5-dipentylcyclooct-3-en-1-ylidene]nonoxy]-2-nonoxyethyl]isoindole-1,3-dione |
| SMILES | CCCCCCCCCOC(CN1C(=O)c2ccccc2C1=O)OCCCCCCCC/C=C1\C/C=C(/CCCCC)C(CCCCC)CCC1 |
| InChI | InChI=1S/C46H75NO4/c1-4-7-10-11-14-17-24-36-50-44(38-47-45(48)42-32-22-23-33-43(42)46(47)49)51-37-25-18-15-12-13-16-21-27-39-28-26-31-40(29-19-8-5-2)41(35-34-39)30-20-9-6-3/h22-23,27,32-33,35,40,44H,4-21,24-26,28-31,34,36-38H2,1-3H3/b39-27-,41-35- |
| InChIKey | FJWCXKHTGHEFNU-HFYYKHEOSA-N |
| XLogP | 13.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.11 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|