About ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate
ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate (PubChem CID 129190929) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate |
| PubChem CID | 129190929 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate |
| SMILES | CCOC(=O)CCC(C)(/C=C\CC(C)(C)CC)CC |
| InChI | InChI=1S/C17H32O2/c1-7-16(4,5)12-10-13-17(6,8-2)14-11-15(18)19-9-3/h10,13H,7-9,11-12,14H2,1-6H3/b13-10- |
| InChIKey | BSMHDIFXGPAYPQ-RAXLEYEMSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate?
The IUPAC name of ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate (CID 129190929) is ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate.
What is the SMILES notation for ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate?
The canonical SMILES for ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate is CCOC(=O)CCC(C)(/C=C\CC(C)(C)CC)CC.
What is the InChIKey of ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate?
The InChIKey is BSMHDIFXGPAYPQ-RAXLEYEMSA-N. The full InChI is InChI=1S/C17H32O2/c1-7-16(4,5)12-10-13-17(6,8-2)14-11-15(18)19-9-3/h10,13H,7-9,11-12,14H2,1-6H3/b13-10-.
What are the key properties of ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate?
ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate has a molecular weight of 268.44 g/mol, XLogP of 5.13, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-4-ethyl-4,8,8-trimethyldec-5-enoate is sourced from PubChem (CID 129190929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).